ChemNet > CAS > 78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
Nama produk |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile |
Sinonim |
2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzonitrile |
MF |
C13H7ClN2O2S |
Berat Molekul |
290.7249 |
InChI |
InChI=1/C13H7ClN2O2S/c14-10-1-4-12(5-2-10)19-13-6-3-11(16(17)18)7-9(13)8-15/h1-7H |
CAS NO |
78940-73-5 |
Struktur Molekul |
|
Kepadatan |
1.47g/cm3 |
Titik lebur |
167℃ |
Titik didih |
452.8°C at 760 mmHg |
Indeks bias |
1.685 |
Titik nyala |
227.6°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|